Zinc gluconate, formula C12H22O14Zn, supports immune function and wound healing. It aids in maintaining skin health and plays a role in enzymatic reactions within the body.
| IUPAC Name | Zinc D-gluconate |
| Molecular Formula | C12H22O14Zn |
| CAS Number | 4468-02-4 |
| Synonyms | Zinc(II) gluconate, Zinc salt of gluconic acid, Zincgluconate |
| InChI | InChI=1S/2C6H12O7.Zn/c27-1-2(8)3(9)4(10)5(11)6(12)13;/h22-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*3-,4+,5-;/m11./s1 |
Zinc Gluconate Properties
Zinc Gluconate Formula
The formula of zinc salt of gluconic acid is C12H22O14Zn. It represents the arrangement of atoms in a molecule. This formula highlights the presence of carbon, hydrogen, oxygen, and zinc atoms within the compound.
Zinc Gluconate Molar Mass
Zinc salt of gluconic acid has a molar mass of approximately 455.68 g/mol. Molar mass signifies the mass of one mole of a substance and is calculated by summing the atomic masses of its constituent elements.
Zinc Gluconate Boiling Point
Zinc salt of gluconic acid does not have a specific boiling point on its own, as it decomposes before reaching the boiling point due to its molecular structure and properties.
Zinc Gluconate Melting Point
The melting point of zinc salt of gluconic acid typically ranges between 120°C to 130°C. This is the temperature at which the solid compound transitions into a liquid state.
Zinc Gluconate Density g/mL
The density of zinc salt of gluconic acid varies, but it is generally around 1.86 g/mL. Density measures the mass of a substance per unit volume and provides insight into its compactness.
Zinc Gluconate Molecular Weight
With a molecular weight of approximately 455.68 g/mol, zinc salt of gluconic acid’s molecular weight is the sum of the atomic weights of all the atoms present in a single molecule of the compound.
Zinc Gluconate Structure
Zinc salt of gluconic acid features a structure where a zinc ion is coordinated with gluconate ligands. These ligands are derived from gluconic acid, with the carbon, hydrogen, and oxygen atoms forming a specific arrangement around the central zinc atom.
Zinc Gluconate Solubility
Zinc salt of gluconic acid is moderately soluble in water. This solubility arises from the interaction between the polar water molecules and the compound’s ionic or polar regions, allowing it to dissolve and form a solution. The solubility of zinc salt of gluconic acid makes it suitable for various applications, including dietary supplements.
| Appearance | White or off-white powder |
| Specific Gravity | ~1.86 g/cm³ |
| Color | Colorless to pale yellow |
| Odor | Odorless |
| Molar Mass | ~455.68 g/mol |
| Density | ~1.86 g/mL |
| Melting Point | 120°C – 130°C |
| Boiling Point | Decomposes before boiling |
| Flash Point | Not applicable |
| Water Solubility | Moderately soluble in water |
| Solubility | Soluble in aqueous solutions |
| Vapour Pressure | Negligible |
| Vapour Density | Not applicable |
| pKa | ~12.4 (for gluconic acid) |
| pH | Slightly acidic to neutral |
Zinc Gluconate Safety and Hazards
Zinc salt of gluconic acid is generally considered safe when used in dietary supplements and medications within recommended doses. However, excessive consumption can lead to stomach discomfort and nausea. Avoid inhaling its powder and ensure proper handling to prevent irritation. Although low in toxicity, ingesting large amounts might lead to adverse effects. As with handling any substance, it’s wise to adhere to safety guidelines, store it properly, and consult medical professionals before use, especially if pregnant, nursing, or having underlying health conditions.
| Hazard Symbols | No hazard symbols |
| Safety Description | Generally considered safe in specified uses, but excessive consumption can lead to discomfort |
| UN IDs | Not applicable |
| HS Code | 2918.15.0000 |
| Hazard Class | Not classified as hazardous |
| Packing Group | Not applicable |
| Toxicity | Low toxicity with excessive consumption leading to discomfort |
Zinc Gluconate Synthesis Methods
Zinc salt of gluconic acid can be synthesized through different methods. One common approach involves reacting zinc oxide or zinc carbonate with gluconic acid. In this method, the zinc oxide or zinc carbonate is dissolved in water to form a zinc hydroxide solution. Gluconic acid is then added to the solution, leading to a reaction that produces zinc salt of gluconic acid and water. The mixture is usually heated and stirred to facilitate the reaction and ensure complete conversion.
Another method involves the reaction between zinc oxide and gluconolactone. Gluconolactone is hydrolyzed in the presence of water to produce gluconic acid, which then reacts with zinc oxide to yield zinc salt of gluconic acid.
These methods generally require controlled conditions, such as specific temperatures and pH levels, to optimize the reaction. Purification steps may be employed to obtain a more refined product. The synthesis of zinc salt of gluconic acid is crucial for its various applications, including dietary supplements and pharmaceuticals. It’s important to note that while these methods yield zinc salt of gluconic acid, the specific procedures and conditions can vary based on the desired product quality and the scale of production.
Zinc Gluconate Uses
Zinc salt of gluconic acid finds a range of applications due to its beneficial properties and versatility. Its uses span various industries and fields, making it an important compound for multiple purposes.
- Dietary Supplements: Dietary supplements commonly utilize zinc salt of gluconic acid as an essential mineral supporting immune function, wound healing, and overall health.
- Pharmaceuticals: Various over-the-counter and prescription medications incorporate zinc salt of gluconic acid as an active ingredient, including cold remedies, oral lozenges, and skin creams, owing to its potential antiviral and wound healing properties.
- Skin Care Products: Zinc salt of gluconic acid assumes a crucial role in skincare products by promoting wound healing, aiding in skin repair and rejuvenation.
- Oral Health: Oral hygiene products like toothpaste and mouthwashes contain zinc salt of gluconic acid, contributing to oral health and the prevention of dental issues.
- Industrial Applications: Industries employ zinc salt of gluconic acid as a nutrient additive in food and beverages to fortify them with zinc, a vital micronutrient.
- Nutritional Additive: Zinc salt of gluconic acid acts as a nutritional additive in animal feed, ensuring adequate zinc intake for livestock, promoting their health and growth.
- Galvanization: In certain cases, zinc salt of gluconic acid participates in galvanization processes to coat metals with a layer of zinc for corrosion resistance.
- Flavor Enhancement: The food industry exploits zinc salt of gluconic acid to enhance flavors and improve the texture of specific products.
- Medicated Powders: Zinc salt of gluconic acid, known for its soothing properties, becomes a component in medicated powders, aiding in the relief of skin irritation.
- Nutraceuticals: Zinc salt of gluconic acid finds application in nutraceutical formulations, blending nutritional and pharmaceutical aspects to provide health benefits.
Questions:
Q: Is zinc gluconate safe in deodorant?
A: Yes, zinc salt of gluconic acid is used in deodorants for its antibacterial properties, helping to control odor-causing bacteria.
Q: Is zinc gluconate 50 mg good for colds?
A: Zinc salt of gluconic acid at 50 mg may aid in supporting immune function during colds, but consult a healthcare professional for personalized advice.
Q: Is zinc gluconate chelated?
A: Zinc salt of gluconic acid is not typically considered a chelated form of zinc; it’s a salt formed from zinc and gluconic acid.
Q: Is zinc gluconate absorbable?
A: Zinc salt of gluconic acid is absorbable, but absorption can vary based on factors like dosage, dietary factors, and individual differences.
Q: What is the difference between zinc gluconate and zinc picolinate?
A: Zinc salt of gluconic acid and zinc picolinate are different forms of zinc, potentially affecting absorption rates and compatibility with individuals.
Q: What type of reaction is Zn + S = ZnS?
A: The reaction Zn + S = ZnS is a synthesis or combination reaction, forming zinc sulfide (ZnS) from its elements.
Q: Can you take too much zinc gluconate?
A: Yes, excessive intake of zinc gluconate can lead to adverse effects, including gastrointestinal discomfort; adhere to recommended doses.
Q: Is zinc gluconate comparable to chlorhexidine gluconate?
A: Zinc salt of gluconic acid and chlorhexidine gluconate serve different purposes; zinc is used in supplements, while chlorhexidine is an antiseptic.
Q: How absorbable is zinc gluconate?
A: Zinc salt of gluconic acid’s absorption depends on factors like formulation and individual factors; it is generally considered reasonably absorbable.
Q: Is zinc sulfate the same as zinc gluconate?
A: No, zinc sulfate and zinc gluconate are different compounds, with variations in properties, uses, and potential effects.
Q: What elements are in zinc gluconate?
A: Zinc salt of gluconic acid consists of zinc, carbon, hydrogen, and oxygen elements, forming the compound C12H22O14Zn.