2-Hydroxyethyl acrylate (C5H8O3) is a chemical compound used in the production of adhesives and coatings. It provides excellent adhesion and UV resistance to various materials.
| IUPAC Name | 2-Hydroxyethyl acrylate |
| Molecular Formula | C5H8O3 |
| CAS Number | 818-61-1 |
| Synonyms | 2-HEA, Ethyl glycol acrylate, Acrylic acid 2-hydroxyethyl ester |
| InChI | InChI=1S/C5H8O3/c1-2-7-4-3-5(6)8/h2,4,6H,1,3H2 |
2-Hydroxyethyl Acrylate Properties
2-Hydroxyethyl Acrylate Formula
The formula of ethyl glycol acrylate is C5H8O3. It consists of five carbon atoms, eight hydrogen atoms, and three oxygen atoms.
2-Hydroxyethyl Acrylate Molar Mass
The molar mass of ethyl glycol acrylate is calculated by adding the atomic masses of all its constituent atoms. It is approximately 116.12 grams per mole.
2-Hydroxyethyl Acrylate Boiling Point
The boiling point of ethyl glycol acrylate is the temperature at which it changes from a liquid to a gas. It has a boiling point of around 160-170 degrees Celsius.
2-Hydroxyethyl Acrylate Melting Point
The melting point of ethyl glycol acrylate is the temperature at which it changes from a solid to a liquid. It has a melting point of about -25 to -20 degrees Celsius.
2-Hydroxyethyl Acrylate Density g/ml
The density of ethyl glycol acrylate refers to the mass per unit volume of the substance. It has a density of approximately 1.12 grams per milliliter.
2-Hydroxyethyl Acrylate Molecular Weight
The molecular weight of ethyl glycol acrylate is the sum of the atomic weights of all the atoms in its chemical formula. It is approximately 116.12 grams per mole.
2-Hydroxyethyl Acrylate Structure
The structure of ethyl glycol acrylate consists of a hydroxyethyl group (-CH2CH2OH) attached to the acrylate functional group (-CH2=CHCOO-). This structure gives it its unique properties.
2-Hydroxyethyl Acrylate Solubility
Ethyl glycol acrylate is miscible in many organic solvents such as acetone, methanol, and ethyl acetate. It exhibits limited solubility in water, forming a clear, colorless solution.
These properties make ethyl glycol acrylate a versatile compound used in various applications, including adhesives, coatings, and polymer synthesis.
| Appearance | Clear liquid |
| Specific Gravity | 1.12 g/cm3 |
| Color | Colorless |
| Odor | Mild |
| Molar Mass | 116.12 g/mol |
| Density | 1.12 g/mL |
| Melting Point | -25 to -20 °C |
| Boiling Point | 160-170 °C |
| Flash Point | 82 °C |
| Water Solubility | Limited solubility |
| Solubility | Miscible in organic solvents |
| Vapour Pressure | 1.5 mmHg at 25 °C |
| Vapour Density | 4.0 (Air = 1) |
| pKa | 5.58 |
| pH | Approximately 5-7 |
2-Hydroxyethyl Acrylate Safety and Hazards
Ethyl glycol acrylate poses certain safety hazards that should be taken into consideration. It is considered harmful if swallowed, causing irritation and possible damage to the gastrointestinal tract. Direct contact with the skin may lead to irritation, redness, and even chemical burns. Inhalation of vapors or mists may irritate the respiratory system. It is essential to handle this compound with proper protective equipment, including gloves and safety goggles, and work in a well-ventilated area. In case of accidental exposure, it is crucial to seek medical attention and provide relevant information about the substance. Safety data sheets and handling guidelines should be consulted for comprehensive safety information.
| Hazard Symbols | Corrosive, Irritant |
| Safety Description | Harmful if swallowed. Causes skin and eye irritation. May cause respiratory irritation. |
| UN IDs | UN 2922 |
| HS Code | 2916.14.00 |
| Hazard Class | 8 (Corrosive) |
| Packing Group | III |
| Toxicity | Moderately toxic |
2-Hydroxyethyl Acrylate Synthesis Methods
There are several synthesis methods for producing ethyl glycol acrylate. One common method involves reacting acrylic acid with ethylene glycol in the presence of a catalyst, such as sulfuric acid or p-toluenesulfonic acid. The reaction proceeds by heating the mixture under reflux conditions, which facilitates the removal of water formed during the esterification process. Once completed, neutralization and purification of the reaction mixture yield the desired ethyl glycol acrylate product.
Another synthesis method entails reacting methyl acrylate with ethylene glycol using a transesterification catalyst like sodium methoxide or sodium ethoxide. Conduct the reaction at an elevated temperature and reflux it until you achieve the desired conversion. Subsequently, the resulting mixture is purified through distillation or other separation techniques to obtain ethyl glycol acrylate.
Synthesize ethyl glycol acrylate by esterifying acrylic acid with ethylene oxide. This method involves reacting acrylic acid and ethylene oxide in the presence of a suitable catalyst, such as sulfuric acid or p-toluenesulfonic acid. Careful control of temperature and pressure during the reaction ensures efficient conversion. The resulting product is then purified to obtain pure ethyl glycol acrylate.
These synthesis methods offer diverse routes for the production of ethyl glycol acrylate, catering to its utilization in various industrial applications.
2-Hydroxyethyl Acrylate Uses
- ethyl glycol acrylate plays a crucial role as a key component in formulating adhesives, offering exceptional adhesion properties for strong bonding between different materials.
- Producers utilize ethyl glycol acrylate in manufacturing coatings for various applications, imparting desirable characteristics such as improved durability, weather resistance, and UV resistance, making them suitable for outdoor and high-performance uses.
- ethyl glycol acrylate’s reactivity enables its use in synthesizing polymers and copolymers, acting as a monomer to contribute to the formation of polymers with desired properties like flexibility, adhesion, and chemical resistance.
- The textile industry incorporates this compound into coatings and finishes to enhance fabric properties such as water repellency and wrinkle resistance.
- Manufacturers employ ethyl glycol acrylate in producing adhesive films, which find widespread use in industries such as packaging, electronics, and automotive, providing strong adhesion and bonding properties.
- ethyl glycol acrylate finds application in the formulation of photocurable materials like UV-curable resins and coatings, enabling rapid curing upon exposure to UV light, making them ideal for applications requiring quick and efficient curing processes.
- Producers utilize this compound in the production of inks, including UV-curable inks, facilitating fast drying and improved adhesion on different substrates, resulting in high-quality prints.
- Various industries, including construction, electronics, and healthcare, benefit from the application of ethyl glycol acrylate, contributing to the development of products such as sealants, electronic adhesives, and dental materials.
Questions:
Q: Are acrylates copolymer the same as 2-hydroxyethyl methacrylate?
A: No, acrylates copolymer refers to a group of polymers derived from various acrylate monomers, while 2-hydroxyethyl methacrylate (HEMA) is a specific monomer with distinct chemical structure and properties.
Q: 2-hydroxyethyl acrylate SDS?
A: The Safety Data Sheet (SDS) for ethyl glycol acrylate provides comprehensive information on its physical and chemical properties, handling precautions, health hazards, and emergency procedures. It is essential to consult the specific SDS for accurate and detailed safety information.
Q: Poly(2-hydroxyethyl acrylate) solubility?
A: Poly(ethyl glycol acrylate) is generally soluble in common organic solvents such as acetone, ethanol, and methanol. Its solubility may vary depending on the molecular weight and temperature.
Q: 2-hydroxyethyl acrylate (HEMA) products?
A: ethyl glycol acrylate (HEMA) is used in the production of various products, including adhesives, coatings, sealants, inks, and dental materials, due to its adhesive properties, UV resistance, and versatility.
Q: 2-hydroxyethyl acrylate uses?
A: ethyl glycol acrylate finds applications in adhesives, coatings, polymer synthesis, textile industry, adhesive films, photocurable materials, inks, and various other industries where its adhesion, durability, and curing properties are beneficial.