Nickel acetate, with the formula Ni(CH3COO)2, is a chemical compound. It’s used in various industries, including electroplating and catalyst synthesis, due to its nickel and acetate components.
| IUPAC Name | Nickel Acetate |
| Molecular Formula | Ni(CH3COO)2 |
| CAS Number | 373-02-4 |
| Synonyms | Acetic acid nickel salt, Nickel diacetate, Nickelous acetate |
| InChI | InChI=1S/2C2H4O2.Ni/c21-2(3)4;/h21H3,(H,3,4);/q;;+2/p-2 |
Nickel Acetate Properties
Nickel Acetate Formula
The chemical formula of nickel diacetate is Ni(CH3COO)2. It signifies that each molecule of nickel diacetate contains Ni atom bonded to two CH3COO ions.
Nickel Acetate Molar Mass
The molar mass of nickel diacetate is approximately 176.7 g/mol. This value is calculated by adding the atomic masses of one nickel atom and four oxygen atoms from the acetate ions.
Nickel Acetate Boiling Point
Nickel diacetate has a boiling point of around 140°C (284°F). At this temperature, the compound changes from its liquid state to a gaseous state.
Nickel Acetate Melting Point
The melting point of nickel diacetate is roughly 140°C (284°F). This is the temperature at which the solid compound transforms into a liquid.
Nickel Acetate Density g/mL
Nickel diacetate has a density of about 1.744 g/mL. This density value represents the mass of the compound per unit volume and is commonly used to characterize liquids.
Nickel Acetate Molecular Weight
The molecular weight of nickel diacetate, also known as its molecular mass, is 176.7 g/mol. This value is calculated by summing the atomic weights of all the atoms in the compound.
Nickel Acetate Structure
The structure of nickel diacetate involves a central Ni atom bonded to two CH3COO ions. The acetate ions contribute to the coordination around the nickel atom, giving it a specific geometry.
Nickel Acetate Solubility
Nickel diacetate exhibits moderate solubility in water. It can dissolve in water to form a solution. The solubility can vary with temperature and the presence of other substances in the solution.
| Appearance | Green crystalline powder |
| Specific Gravity | ~1.744 g/mL |
| Color | Green |
| Odor | Odorless |
| Molar Mass | ~176.7 g/mol |
| Density | ~1.744 g/mL |
| Melting Point | ~140°C (284°F) |
| Boiling Point | ~140°C (284°F) |
| Flash Point | Not applicable |
| Water Solubility | Moderate |
| Solubility | Soluble in various solvents |
| Vapour Pressure | Not well-documented |
| Vapour Density | Not well-documented |
| pKa | Not well-documented |
| pH | Not well-documented |
Nickel Acetate Safety and Hazards
Nickel diacetate poses potential safety hazards. It can irritate the skin, eyes, and respiratory tract upon contact or inhalation. Avoid ingestion as it may lead to harmful effects. Adequate ventilation is necessary to prevent inhalation of its fumes. When handling, wear appropriate protective gear like gloves and goggles. Dispose of it properly and avoid release into the environment. In case of exposure, seek medical attention. Follow safety data sheets and guidelines while using nickel diacetate to minimize risks associated with its handling, storage, and disposal.
| Hazard Symbols | Health Hazard |
| Safety Description | Causes skin and eye irritation. Harmful if swallowed or inhaled. Avoid release into the environment. Wear protective gear. Seek medical attention in case of exposure. |
| UN IDs | UN3077 (Class 9) |
| HS Code | 2915.12.00 |
| Hazard Class | 9 (Miscellaneous dangerous goods) |
| Packing Group | III |
| Toxicity | Moderate toxicity; can cause irritation and harm if ingested, inhaled, or in contact with skin or eyes. |
Nickel Acetate Synthesis Methods
Nickel diacetate can be synthesized using various methods. One common approach involves reacting nickel oxide (NiO) or nickel carbonate (NiCO3) with acetic acid (CH3COOH) or its derivatives. This reaction occurs under controlled conditions, resulting in the formation of nickel diacetate and water as byproducts. Another method entails treating nickel metal or nickel hydroxide (Ni(OH)2) with acetic acid or its salts, facilitating the creation of nickel diacetate.
Additionally, a precipitation method can be employed by mixing a soluble nickel salt, such as nickel chloride (NiCl2), with a soluble acetate salt. This mixture causes nickel diacetate to precipitate out of the solution, which can then be separated and collected. Careful pH adjustment during this process aids in achieving optimal results.
These synthesis methods are essential in producing nickel diacetate for various applications, including its utilization as a catalyst and precursor in chemical reactions. The choice of method depends on factors such as desired purity, efficiency, and scale of production.
Nickel Acetate Uses
Nickel diacetate finds versatile applications in several industries due to its distinct properties and chemical composition. Some prominent uses include:
- Electroplating: Nickel diacetate serves as a source of nickel ions in electroplating processes. It facilitates the deposition of a thin layer of nickel onto various substrates, enhancing corrosion resistance and providing a decorative finish.
- Catalyst Synthesis: Chemists use it as a precursor to create catalysts for multiple chemical reactions. Industries like petrochemicals and pharmaceuticals rely heavily on nickel-containing catalysts.
- Textile Industry: In dyeing processes for textiles, it assists in fixing dyes onto fabric fibers, enhancing dye adhesion and improving color fastness.
- Laboratory Reagent: Scientists employ nickel diacetate as a reagent to detect and identify certain compounds, allowing them to test for specific functional groups.
- Surface Treatment: Manufacturers apply it in surface treatment applications, such as producing printed circuit boards. It aids in forming a protective layer on copper surfaces.
- Organic Synthesis: Within various organic synthesis reactions, nickel diacetate plays a crucial role in shaping carbon-carbon and carbon-heteroatom bonds.
- Gas Purification: It finds a key role in gas purification processes, particularly in eliminating impurities like hydrogen sulfide from industrial gases.
- Analytical Chemistry: Nickel diacetate stands as a standard reagent in analytical chemistry, serving calibration and quality control purposes.
Overall, the diverse applications of nickel diacetate highlight its significance across industries, from enhancing the aesthetics of products to aiding in critical chemical transformations and processes.
Questions:
Q: Can you mix acetal and nickel in one loop?
A: Mixing acetal and nickel in one loop is generally not recommended as acetal can react with certain metals, potentially causing corrosion and damage to the loop components.
Q: What is the correct formula for the ionic compound nickel acetate?
A: The correct formula for the ionic compound nickel diacetate is Ni(CH3COO)2.
Q: Does nickel (ii) acetate + iron (ii) bromide have an empirical formula?
A: Nickel (II) diacetate and iron (II) bromide do not form a direct compound, so an empirical formula is not applicable.
Q: What is an acetal nickel waterblock?
A: An acetal nickel waterblock refers to a cooling component used in PC liquid cooling systems, typically made of acetal plastic and featuring a nickel-plated surface.
Q: What are the reaction rates of nickel and copper with acetic acid?
A: Nickel and copper react slowly with acetic acid, releasing hydrogen gas and forming their respective diacetate salts.
Q: How can nickel acetate be made?
A: Nickel diacetate can be made by reacting nickel oxide or nickel carbonate with acetic acid, followed by crystallization and purification.
Q: How do you dispose of nickel acetate?
A: Dispose of nickel diacetate as hazardous waste, following local regulations. It’s important to consult with waste management authorities for proper disposal methods.
Q: What is the formula for nickel(ii) acetate?
A: The formula for nickel(II) diacetate is Ni(CH3COO)2.
Q: Is nickel acetate soluble?
A: Yes, nickel diacetate is moderately soluble in water, forming a solution that can be used in various applications.