Ammonium acetate is a compound used in various industries. It acts as a source of acetate ions and plays a role in chemical reactions and organic synthesis.
| IUPAC Name | Ammonium acetate |
| Molecular Formula | C2H7NO2 |
| CAS Number | 631-61-8 |
| Synonyms | Acetic acid ammonium salt, Ammonium ethanoate, Ammonium acetic acid, Acetic acid, ammonium salt |
| InChI | InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3 |
Ammonium Acetate Properties
Ammonium Acetate Formula
The formula of acetic acid ammonium salt is C2H7NO2. It consists of two carbon atoms, seven hydrogen atoms, one nitrogen atom, and two oxygen atoms.
Ammonium Acetate Molar Mass
The molar mass of acetic acid ammonium salt is calculated by adding the atomic masses of its constituent elements. It is approximately 77.0825 grams per mole.
Ammonium Acetate Boiling Point
Acetic acid ammonium salt has a boiling point of around 117 degrees Celsius. At this temperature, the compound undergoes a phase change from liquid to gas.
Ammonium Acetate Melting Point
The melting point of acetic acid ammonium salt is about 114 degrees Celsius. This is the temperature at which the solid compound transitions into a liquid state.
Ammonium Acetate Density g/mL
The density of acetic acid ammonium salt is approximately 1.17 grams per milliliter. It is a measure of the mass per unit volume of the compound.
Ammonium Acetate Molecular Weight
The molecular weight of acetic acid ammonium salt is approximately 77.0825 grams per mole. It is the sum of the atomic weights of all the atoms present in the compound.
Ammonium Acetate Structure
The structure of acetic acid ammonium salt consists of an NH4+ and a CH3COO- ion. The NH4+ ion is positively charged, while the CH3COO- ion is negatively charged.
Ammonium Acetate Solubility
Acetic acid ammonium salt is highly soluble in water. It readily dissolves in water to form a clear, colorless solution. The solubility of acetic acid ammonium salt in water is due to its ability to form hydrogen bonds with water molecules.
| Appearance | White crystalline solid |
| Specific Gravity | 1.17 g/mL |
| Color | Colorless |
| Odor | Odorless |
| Molar Mass | 77.0825 g/mol |
| Density | 1.17 g/mL |
| Melting Point | 114 °C |
| Boiling Point | 117 °C |
| Flash Point | Not applicable |
| Water Solubility | highly soluble in water |
| Solubility | Soluble in water, acetic acid, ethanol |
| Vapour Pressure | Not available |
| Vapour Density | Not available |
| pKa | 4.75 |
| pH | Approximately 6.0-7.0 |
Ammonium Acetate Safety and Hazards
Acetic acid ammonium salt poses minimal safety hazards when handled properly. It is generally considered safe for use in various applications. However, like any chemical, precautions should be taken. Avoid inhalation of dust or vapors, as it may cause respiratory irritation. It is advisable to wear appropriate personal protective equipment, including gloves and safety glasses when working with acetic acid ammonium salt. In case of accidental ingestion or contact with the eyes or skin, rinse thoroughly with water and seek medical attention if necessary. Store acetic acid ammonium salt in a cool, dry place away from incompatible substances. Follow proper handling and disposal procedures to ensure safety.
| Hazard Symbols | None |
| Safety Description | Low toxicity |
| UN IDs | Not regulated |
| HS Code | 2915.29.10 |
| Hazard Class | Acetic acid ammonium salt is Not classified |
| Packing Group | Not applicable |
| Toxicity | Low toxicity |
Ammonium Acetate Synthesis Methods
There are several methods for synthesizing acetic acid ammonium salt. One common approach involves mixing acetic acid with an aqueous solution of ammonium carbonate. The reaction between them produces acetic acid ammonium salt and water. This method requires controlling the temperature and pressure during the reaction.
In another method, chemists gradually add acetic acid to an ammonia solution while stirring until the desired pH is achieved. This neutralization process converts the acetic acid into acetic acid ammonium salt. Careful mixing and pH control are essential during this reaction.
Use ammonium hydroxide to synthesize acetic acid ammonium salt by combining it with acetic acid, resulting in the formation of acetic acid ammonium salt and water. Monitor the progress of this reaction until it is complete.
Mix acetic anhydride with ammonium hydroxide or ammonia to prepare acetic acid ammonium salt. The reaction between these reactants results in the formation of acetic acid ammonium salt.
Remember, it is crucial to conduct the synthesis of acetic acid ammonium salt in a well-ventilated area and adhere to proper safety measures. Throughout the synthesis process, ensure the appropriate handling and storage of chemicals.
Ammonium Acetate Uses
Acetic acid ammonium salt finds various applications in different industries due to its versatile properties. Here are some common uses:
- Acetic acid ammonium salt buffers solutions and maintains a stable pH level in chemical and biological laboratories.
- Analytical methods like chromatography and mass spectrometry utilize acetic acid ammonium salt as a reagent for the ionization and separation of compounds.
- Molecular biology employs acetic acid ammonium salt to precipitate DNA during purification procedures, removing contaminants and impurities.
- Acetic acid ammonium salt participates in numerous chemical reactions, acting as a source of acetate ions in organic synthesis, esterification reactions, and catalytic processes.
- In agriculture, acetic acid ammonium salt serves as a nitrogen source in fertilizers, promoting plant growth and development.
- Textile industries use acetic acid ammonium salt for dyeing and printing fabrics, enhancing color fastness by fixing dyes onto the fabric.
- The food industry approves acetic acid ammonium salt as a food additive, regulating acidity to control the pH of various food products.
- In chemical analysis techniques like HPLC (high-performance liquid chromatography), acetic acid ammonium salt aids in separating and detecting compounds.
Overall, acetic acid ammonium salt is a versatile compound with uses ranging from laboratory applications to agriculture and the food industry. Its unique properties make it an important ingredient in various processes and products.
Questions:
Q: How many hydrogen atoms are present in one molecule of ammonium acetate, NH4C2H3O2?
A: There are four hydrogen atoms in one molecule of acetic acid ammonium salt (NH4C2H3O2).
Q: Is ammonium acetate soluble?
A: Yes, acetic acid ammonium salt is soluble in water.
Q: What is the formula for ammonium acetate?
A: The formula for acetic acid ammonium salt is NH4C2H3O2.
Q: Is ammonium acetate soluble in water?
A: Yes, acetic acid ammonium salt is soluble in water.
Q: How to prepare 1 M ammonium acetate?
A: To prepare 1 M acetic acid ammonium salt, dissolve the appropriate amount of ammonium acetate in water to achieve a concentration of 1 mole per liter (M).
Q: How many total moles of ions are released when 0.624 moles of ammonium acetate is dissolved in water?
A: When 0.624 moles of acetic acid ammonium salt is dissolved in water, a total of 1.248 moles of ions (NH4+ and C2H3O2-) are released.
Q: What is the exact molecular weight of ammonium acetate (NH4OAc)?
A: The exact molecular weight of acetic acid ammonium salt (NH4OAc) is approximately 77.0825 grams per mole.
Q: How to make 5 M ammonium acetate?
A: To make 5 M acetic acid ammonium salt, dissolve the appropriate amount of ammonium acetate in water to achieve a concentration of 5 moles per liter (M).
Q: What is the pKa of acetic acid and pKb of ammonium hydroxide?
A: The pKa of acetic acid is approximately 4.75, and the pKb of acetic acid ammonium salt is approximately 4.25.